C12H15F2N3S — CID 113499218
1-(1-ethylsulfanylpropan-2-yl)-4,6-difluorobenzimidazol-2-amine (PubChem CID 113499218) has the molecular formula C12H15F2N3S and a molecular weight of 271.34 g/mol. Its IUPAC name is 1-(1-ethylsulfanylpropan-2-yl)-4,6-difluorobenzimidazol-2-amine.
| Compound Name | 1-(1-ethylsulfanylpropan-2-yl)-4,6-difluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 113499218 |
| Molecular Formula | C12H15F2N3S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-(1-ethylsulfanylpropan-2-yl)-4,6-difluorobenzimidazol-2-amine |
| SMILES | CCSCC(C)n1c(N)nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C12H15F2N3S/c1-3-18-6-7(2)17-10-5-8(13)4-9(14)11(10)16-12(17)15/h4-5,7H,3,6H2,1-2H3,(H2,15,16) |
| InChIKey | NUPLDJYJPVQKLZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |