C13H15F2N3O2 — CID 115508780
methyl 2-(2-amino-4,6-difluorobenzimidazol-1-yl)-3-methylbutanoate (PubChem CID 115508780) has the molecular formula C13H15F2N3O2 and a molecular weight of 283.28 g/mol. Its IUPAC name is methyl 2-(2-amino-4,6-difluorobenzimidazol-1-yl)-3-methylbutanoate.
| Compound Name | methyl 2-(2-amino-4,6-difluorobenzimidazol-1-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 115508780 |
| Molecular Formula | C13H15F2N3O2 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | methyl 2-(2-amino-4,6-difluorobenzimidazol-1-yl)-3-methylbutanoate |
| SMILES | COC(=O)C(C(C)C)n1c(N)nc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C13H15F2N3O2/c1-6(2)11(12(19)20-3)18-9-5-7(14)4-8(15)10(9)17-13(18)16/h4-6,11H,1-3H3,(H2,16,17) |
| InChIKey | RGOLSSYNTGZHMN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |