C17H18ClF3N4Si — CID 11350065
7-chloro-6-(2,4,6-trifluorophenyl)-N-(1-trimethylsilylethyl)imidazo[1,2-a]pyrimidin-5-amine (PubChem CID 11350065) has the molecular formula C17H18ClF3N4Si and a molecular weight of 398.89 g/mol. Its IUPAC name is 7-chloro-6-(2,4,6-trifluorophenyl)-N-(1-trimethylsilylethyl)imidazo[1,2-a]pyrimidin-5-amine.
| Compound Name | 7-chloro-6-(2,4,6-trifluorophenyl)-N-(1-trimethylsilylethyl)imidazo[1,2-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 11350065 |
| Molecular Formula | C17H18ClF3N4Si |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 7-chloro-6-(2,4,6-trifluorophenyl)-N-(1-trimethylsilylethyl)imidazo[1,2-a]pyrimidin-5-amine |
| SMILES | CC(Nc1c(-c2c(F)cc(F)cc2F)c(Cl)nc2nccn12)[Si](C)(C)C |
| InChI | InChI=1S/C17H18ClF3N4Si/c1-9(26(2,3)4)23-16-14(13-11(20)7-10(19)8-12(13)21)15(18)24-17-22-5-6-25(16)17/h5-9,23H,1-4H3 |
| InChIKey | YZCPKXXGPBQCFK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|