C16H16ClF3N4Si — CID 58941474
7-chloro-6-(2,4,6-trifluorophenyl)-N-(trimethylsilylmethyl)imidazo[1,2-a]pyrimidin-5-amine (PubChem CID 58941474) has the molecular formula C16H16ClF3N4Si and a molecular weight of 384.87 g/mol. Its IUPAC name is 7-chloro-6-(2,4,6-trifluorophenyl)-N-(trimethylsilylmethyl)imidazo[1,2-a]pyrimidin-5-amine.
| Compound Name | 7-chloro-6-(2,4,6-trifluorophenyl)-N-(trimethylsilylmethyl)imidazo[1,2-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 58941474 |
| Molecular Formula | C16H16ClF3N4Si |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 7-chloro-6-(2,4,6-trifluorophenyl)-N-(trimethylsilylmethyl)imidazo[1,2-a]pyrimidin-5-amine |
| SMILES | C[Si](C)(C)CNc1c(-c2c(F)cc(F)cc2F)c(Cl)nc2nccn12 |
| InChI | InChI=1S/C16H16ClF3N4Si/c1-25(2,3)8-22-15-13(12-10(19)6-9(18)7-11(12)20)14(17)23-16-21-4-5-24(15)16/h4-7,22H,8H2,1-3H3 |
| InChIKey | TVGDRAIPNKEZGB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|