C19H21ClF3N5 — CID 15483676
5-chloro-6-(2,4,6-trifluorophenyl)-N-(2,4,4-trimethylpentan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 15483676) has the molecular formula C19H21ClF3N5 and a molecular weight of 411.86 g/mol. Its IUPAC name is 5-chloro-6-(2,4,6-trifluorophenyl)-N-(2,4,4-trimethylpentan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-6-(2,4,6-trifluorophenyl)-N-(2,4,4-trimethylpentan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 15483676 |
| Molecular Formula | C19H21ClF3N5 |
| Molecular Weight | 411.86 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 5-chloro-6-(2,4,6-trifluorophenyl)-N-(2,4,4-trimethylpentan-2-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC(C)(C)CC(C)(C)Nc1c(-c2c(F)cc(F)cc2F)c(Cl)nc2ncnn12 |
| InChI | InChI=1S/C19H21ClF3N5/c1-18(2,3)8-19(4,5)27-16-14(13-11(22)6-10(21)7-12(13)23)15(20)26-17-24-9-25-28(16)17/h6-7,9,27H,8H2,1-5H3 |
| InChIKey | KNVZVUHTIACIRZ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.86 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |