C14H12ClF3N6 — CID 58819889
1-[5-chloro-6-(2,4,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-1-propylhydrazine (PubChem CID 58819889) has the molecular formula C14H12ClF3N6 and a molecular weight of 356.74 g/mol. Its IUPAC name is 1-[5-chloro-6-(2,4,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-1-propylhydrazine.
| Compound Name | 1-[5-chloro-6-(2,4,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-1-propylhydrazine |
|---|---|
| PubChem CID | 58819889 |
| Molecular Formula | C14H12ClF3N6 |
| Molecular Weight | 356.74 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 1-[5-chloro-6-(2,4,6-trifluorophenyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-1-propylhydrazine |
| SMILES | CCCN(N)c1c(-c2c(F)cc(F)cc2F)c(Cl)nc2ncnn12 |
| InChI | InChI=1S/C14H12ClF3N6/c1-2-3-23(19)13-11(10-8(17)4-7(16)5-9(10)18)12(15)22-14-20-6-21-24(13)14/h4-6H,2-3,19H2,1H3 |
| InChIKey | ZPHUYYFCIYJCRS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|