C11H3Cl2F2IN4 — CID 166514871
5,7-dichloro-6-(2,6-difluoro-4-iodophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 166514871) has the molecular formula C11H3Cl2F2IN4 and a molecular weight of 426.98 g/mol. Its IUPAC name is 5,7-dichloro-6-(2,6-difluoro-4-iodophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 5,7-dichloro-6-(2,6-difluoro-4-iodophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 166514871 |
| Molecular Formula | C11H3Cl2F2IN4 |
| Molecular Weight | 426.98 g/mol |
| Exact Mass | 425.87 |
| IUPAC Name | 5,7-dichloro-6-(2,6-difluoro-4-iodophenyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Fc1cc(I)cc(F)c1-c1c(Cl)nc2ncnn2c1Cl |
| InChI | InChI=1S/C11H3Cl2F2IN4/c12-9-8(7-5(14)1-4(16)2-6(7)15)10(13)20-11(19-9)17-3-18-20/h1-3H |
| InChIKey | ZRGQHQYCICNNMX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.98 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|