C12H21O4P — CID 11350093
6-diethoxyphosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol (PubChem CID 11350093) has the molecular formula C12H21O4P and a molecular weight of 260.27 g/mol. Its IUPAC name is 6-diethoxyphosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol.
| Compound Name | 6-diethoxyphosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol |
|---|---|
| PubChem CID | 11350093 |
| Molecular Formula | C12H21O4P |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 6-diethoxyphosphoryl-4,4-dimethylcyclohexa-1,5-dien-1-ol |
| SMILES | CCOP(=O)(OCC)C1=CC(C)(C)CC=C1O |
| InChI | InChI=1S/C12H21O4P/c1-5-15-17(14,16-6-2)11-9-12(3,4)8-7-10(11)13/h7,9,13H,5-6,8H2,1-4H3 |
| InChIKey | CHYMAQQPQAPFPN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|