C22H27N5O3 — CID 11350372
ethyl (2E)-2-[[4-[6-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]pyridazin-3-yl]phenyl]hydrazinylidene]propanoate (PubChem CID 11350372) has the molecular formula C22H27N5O3 and a molecular weight of 409.49 g/mol. Its IUPAC name is ethyl (2E)-2-[[4-[6-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]pyridazin-3-yl]phenyl]hydrazinylidene]propanoate.
| Compound Name | ethyl (2E)-2-[[4-[6-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]pyridazin-3-yl]phenyl]hydrazinylidene]propanoate |
|---|---|
| PubChem CID | 11350372 |
| Molecular Formula | C22H27N5O3 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | ethyl (2E)-2-[[4-[6-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]oxy]pyridazin-3-yl]phenyl]hydrazinylidene]propanoate |
| SMILES | CCOC(=O)/C(C)=N/Nc1ccc(-c2ccc(O[C@H]3CN4CCC3CC4)nn2)cc1 |
| InChI | InChI=1S/C22H27N5O3/c1-3-29-22(28)15(2)23-24-18-6-4-16(5-7-18)19-8-9-21(26-25-19)30-20-14-27-12-10-17(20)11-13-27/h4-9,17,20,24H,3,10-14H2,1-2H3/b23-15+/t20-/m0/s1 |
| InChIKey | ADGVFDLEJQELHZ-VRMLFSPKSA-N |
| XLogP | 2.97 |
| TPSA | 88.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|