C25H33N5O2 — CID 11351050
N-[1-[(Z)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]-4-(4-methoxyphenyl)butanamide (PubChem CID 11351050) has the molecular formula C25H33N5O2 and a molecular weight of 435.57 g/mol. Its IUPAC name is N-[1-[(Z)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]-4-(4-methoxyphenyl)butanamide.
| Compound Name | N-[1-[(Z)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]-4-(4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 11351050 |
| Molecular Formula | C25H33N5O2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | N-[1-[(Z)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]-4-(4-methoxyphenyl)butanamide |
| SMILES | COc1ccc(CCCC(=O)NC(/N=C(\NC#N)Nc2ccccc2C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H33N5O2/c1-18-9-6-7-11-21(18)28-24(27-17-26)30-23(25(2,3)4)29-22(31)12-8-10-19-13-15-20(32-5)16-14-19/h6-7,9,11,13-16,23H,8,10,12H2,1-5H3,(H,29,31)(H2,27,28,30) |
| InChIKey | FQMPCLYFSSMAJX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|