C30H22N2O3 — CID 11351585
10-benzyl-4,5-diphenyl-5H-furo[3,4-b][1,4]benzodiazepine-1,3-dione (PubChem CID 11351585) has the molecular formula C30H22N2O3 and a molecular weight of 458.52 g/mol. Its IUPAC name is 10-benzyl-4,5-diphenyl-5H-furo[3,4-b][1,4]benzodiazepine-1,3-dione.
| Compound Name | 10-benzyl-4,5-diphenyl-5H-furo[3,4-b][1,4]benzodiazepine-1,3-dione |
|---|---|
| PubChem CID | 11351585 |
| Molecular Formula | C30H22N2O3 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 10-benzyl-4,5-diphenyl-5H-furo[3,4-b][1,4]benzodiazepine-1,3-dione |
| SMILES | O=C1OC(=O)C2=C1N(Cc1ccccc1)c1ccccc1C(c1ccccc1)N2c1ccccc1 |
| InChI | InChI=1S/C30H22N2O3/c33-29-27-28(30(34)35-29)32(23-16-8-3-9-17-23)26(22-14-6-2-7-15-22)24-18-10-11-19-25(24)31(27)20-21-12-4-1-5-13-21/h1-19,26H,20H2 |
| InChIKey | YPWLAMNVOBNFEO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|