C19H14N6S — CID 11353763
(2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(pyridin-4-ylmethylamino)pyrimidin-4-yl]acetonitrile (PubChem CID 11353763) has the molecular formula C19H14N6S and a molecular weight of 358.43 g/mol. Its IUPAC name is (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(pyridin-4-ylmethylamino)pyrimidin-4-yl]acetonitrile.
| Compound Name | (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(pyridin-4-ylmethylamino)pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 11353763 |
| Molecular Formula | C19H14N6S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-(pyridin-4-ylmethylamino)pyrimidin-4-yl]acetonitrile |
| SMILES | N#C/C(=C1/Nc2ccccc2S1)c1ccnc(NCc2ccncc2)n1 |
| InChI | InChI=1S/C19H14N6S/c20-11-14(18-24-16-3-1-2-4-17(16)26-18)15-7-10-22-19(25-15)23-12-13-5-8-21-9-6-13/h1-10,24H,12H2,(H,22,23,25)/b18-14+ |
| InChIKey | NOGTXAOWPCAFHN-NBVRZTHBSA-N |
| XLogP | 3.89 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|