C30H33N7O7 — CID 11353933
2-[[4-[6-(hexylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid (PubChem CID 11353933) has the molecular formula C30H33N7O7 and a molecular weight of 603.64 g/mol. Its IUPAC name is 2-[[4-[6-(hexylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid.
| Compound Name | 2-[[4-[6-(hexylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 11353933 |
| Molecular Formula | C30H33N7O7 |
| Molecular Weight | 603.64 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | 2-[[4-[6-(hexylcarbamoylamino)purin-9-yl]-2-phenyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methoxy]pyridine-3-carboxylic acid |
| SMILES | CCCCCCNC(=O)Nc1ncnc2c1ncn2C1OC(COc2ncccc2C(=O)O)C2OC(c3ccccc3)OC21 |
| InChI | InChI=1S/C30H33N7O7/c1-2-3-4-8-13-32-30(40)36-24-21-25(34-16-33-24)37(17-35-21)27-23-22(43-29(44-23)18-10-6-5-7-11-18)20(42-27)15-41-26-19(28(38)39)12-9-14-31-26/h5-7,9-12,14,16-17,20,22-23,27,29H,2-4,8,13,15H2,1H3,(H,38,39)(H2,32,33,34,36,40) |
| InChIKey | MYBOEWSIEVCEPR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 171.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.64 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|