C6H11NO7S — CID 11356899
(2R)-6-amino-6-oxo-2-sulfooxyhexanoic acid (PubChem CID 11356899) has the molecular formula C6H11NO7S and a molecular weight of 241.22 g/mol. Its IUPAC name is (2R)-6-amino-6-oxo-2-sulfooxyhexanoic acid.
| Compound Name | (2R)-6-amino-6-oxo-2-sulfooxyhexanoic acid |
|---|---|
| PubChem CID | 11356899 |
| Molecular Formula | C6H11NO7S |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | (2R)-6-amino-6-oxo-2-sulfooxyhexanoic acid |
| SMILES | NC(=O)CCC[C@@H](OS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C6H11NO7S/c7-5(8)3-1-2-4(6(9)10)14-15(11,12)13/h4H,1-3H2,(H2,7,8)(H,9,10)(H,11,12,13)/t4-/m1/s1 |
| InChIKey | GPCUUMBSIAGGTL-SCSAIBSYSA-N |
| XLogP | -1.09 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|