C13H17BrO2 — CID 11358091
[(Z,2S)-4-bromo-4-(cyclohexen-1-yl)but-3-en-2-yl] prop-2-enoate (PubChem CID 11358091) has the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. Its IUPAC name is [(Z,2S)-4-bromo-4-(cyclohexen-1-yl)but-3-en-2-yl] prop-2-enoate.
| Compound Name | [(Z,2S)-4-bromo-4-(cyclohexen-1-yl)but-3-en-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 11358091 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | [(Z,2S)-4-bromo-4-(cyclohexen-1-yl)but-3-en-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@@H](C)/C=C(\Br)C1=CCCCC1 |
| InChI | InChI=1S/C13H17BrO2/c1-3-13(15)16-10(2)9-12(14)11-7-5-4-6-8-11/h3,7,9-10H,1,4-6,8H2,2H3/b12-9-/t10-/m0/s1 |
| InChIKey | JYLYXBQHMICSEW-JMZICWNOSA-N |
| XLogP | 3.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|