C22H19NO2 — CID 11359410
1-methyl-4-(4-propan-2-ylphenyl)indeno[1,2-b]pyridine-2,5-dione (PubChem CID 11359410) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-methyl-4-(4-propan-2-ylphenyl)indeno[1,2-b]pyridine-2,5-dione.
| Compound Name | 1-methyl-4-(4-propan-2-ylphenyl)indeno[1,2-b]pyridine-2,5-dione |
|---|---|
| PubChem CID | 11359410 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-methyl-4-(4-propan-2-ylphenyl)indeno[1,2-b]pyridine-2,5-dione |
| SMILES | CC(C)c1ccc(-c2cc(=O)n(C)c3c2C(=O)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C22H19NO2/c1-13(2)14-8-10-15(11-9-14)18-12-19(24)23(3)21-16-6-4-5-7-17(16)22(25)20(18)21/h4-13H,1-3H3 |
| InChIKey | JXEWIYPKIDWVBE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|