C20H18N3S+ — CID 11361933
N-[(4-methylphenyl)methyl]-N-pyridin-1-ium-1-yl-1,3-benzothiazol-2-amine (PubChem CID 11361933) has the molecular formula C20H18N3S+ and a molecular weight of 332.45 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-N-pyridin-1-ium-1-yl-1,3-benzothiazol-2-amine.
| Compound Name | N-[(4-methylphenyl)methyl]-N-pyridin-1-ium-1-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 11361933 |
| Molecular Formula | C20H18N3S+ |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-N-pyridin-1-ium-1-yl-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc(CN(c2nc3ccccc3s2)[n+]2ccccc2)cc1 |
| InChI | InChI=1S/C20H18N3S/c1-16-9-11-17(12-10-16)15-23(22-13-5-2-6-14-22)20-21-18-7-3-4-8-19(18)24-20/h2-14H,15H2,1H3/q+1 |
| InChIKey | WLVJOJXBDUUZDE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|