C26H20F3NO4 — CID 11363335
morpholin-4-yl-(6,6',13'-trifluorospiro[1,3-benzodioxole-2,2'-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene]-5-yl)methanone (PubChem CID 11363335) has the molecular formula C26H20F3NO4 and a molecular weight of 467.44 g/mol. Its IUPAC name is morpholin-4-yl-(6,6',13'-trifluorospiro[1,3-benzodioxole-2,2'-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene]-5-yl)methanone.
| Compound Name | morpholin-4-yl-(6,6',13'-trifluorospiro[1,3-benzodioxole-2,2'-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene]-5-yl)methanone |
|---|---|
| PubChem CID | 11363335 |
| Molecular Formula | C26H20F3NO4 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | morpholin-4-yl-(6,6',13'-trifluorospiro[1,3-benzodioxole-2,2'-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene]-5-yl)methanone |
| SMILES | O=C(c1cc2c(cc1F)OC1(O2)c2ccc(F)cc2CCc2cc(F)ccc21)N1CCOCC1 |
| InChI | InChI=1S/C26H20F3NO4/c27-17-3-5-20-15(11-17)1-2-16-12-18(28)4-6-21(16)26(20)33-23-13-19(22(29)14-24(23)34-26)25(31)30-7-9-32-10-8-30/h3-6,11-14H,1-2,7-10H2 |
| InChIKey | MEILNHUHBIAXPX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |