About [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone
[6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone (PubChem CID 22475107) has the molecular formula C24H18F3NO4
and a molecular weight of 441.41 g/mol. Its IUPAC name is [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone |
| PubChem CID | 22475107 |
| Molecular Formula | C24H18F3NO4 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cc2c(cc1F)OC(c1cccc(F)c1)(c1cccc(F)c1)O2)N1CCOCC1 |
| InChI | InChI=1S/C24H18F3NO4/c25-17-5-1-3-15(11-17)24(16-4-2-6-18(26)12-16)31-21-13-19(20(27)14-22(21)32-24)23(29)28-7-9-30-10-8-28/h1-6,11-14H,7-10H2 |
| InChIKey | DEGHWTDLPSPDGE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone?
The IUPAC name of [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone (CID 22475107) is [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone is O=C(c1cc2c(cc1F)OC(c1cccc(F)c1)(c1cccc(F)c1)O2)N1CCOCC1.
What is the InChIKey of [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone?
The InChIKey is DEGHWTDLPSPDGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18F3NO4/c25-17-5-1-3-15(11-17)24(16-4-2-6-18(26)12-16)31-21-13-19(20(27)14-22(21)32-24)23(29)28-7-9-30-10-8-28/h1-6,11-14H,7-10H2.
What are the key properties of [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone?
[6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone has a molecular weight of 441.41 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-fluoro-2,2-bis(3-fluorophenyl)-1,3-benzodioxol-5-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 22475107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).