C25H22BrNO3 — CID 22475170
(6-bromo-2,2-diphenyl-1,3-benzodioxol-5-yl)-piperidin-1-ylmethanone (PubChem CID 22475170) has the molecular formula C25H22BrNO3 and a molecular weight of 464.36 g/mol. Its IUPAC name is (6-bromo-2,2-diphenyl-1,3-benzodioxol-5-yl)-piperidin-1-ylmethanone.
| Compound Name | (6-bromo-2,2-diphenyl-1,3-benzodioxol-5-yl)-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 22475170 |
| Molecular Formula | C25H22BrNO3 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | (6-bromo-2,2-diphenyl-1,3-benzodioxol-5-yl)-piperidin-1-ylmethanone |
| SMILES | O=C(c1cc2c(cc1Br)OC(c1ccccc1)(c1ccccc1)O2)N1CCCCC1 |
| InChI | InChI=1S/C25H22BrNO3/c26-21-17-23-22(16-20(21)24(28)27-14-8-3-9-15-27)29-25(30-23,18-10-4-1-5-11-18)19-12-6-2-7-13-19/h1-2,4-7,10-13,16-17H,3,8-9,14-15H2 |
| InChIKey | VLWTYITXDDMXHO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |