C24H24FNO4 — CID 160782561
benzene;(6-fluoro-1,3-benzodioxol-5-yl)-morpholin-4-ylmethanone (PubChem CID 160782561) has the molecular formula C24H24FNO4 and a molecular weight of 409.46 g/mol. Its IUPAC name is benzene;(6-fluoro-1,3-benzodioxol-5-yl)-morpholin-4-ylmethanone.
| Compound Name | benzene;(6-fluoro-1,3-benzodioxol-5-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 160782561 |
| Molecular Formula | C24H24FNO4 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | benzene;(6-fluoro-1,3-benzodioxol-5-yl)-morpholin-4-ylmethanone |
| SMILES | O=C(c1cc2c(cc1F)OCO2)N1CCOCC1.c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C12H12FNO4.2C6H6/c13-9-6-11-10(17-7-18-11)5-8(9)12(15)14-1-3-16-4-2-14;2*1-2-4-6-5-3-1/h5-6H,1-4,7H2;2*1-6H |
| InChIKey | SATPSQMQEQHYHC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |