C25H50O2S2Sn — CID 11365068
(E,2S,3S)-1-(1,3-dithian-2-yl)-2-methoxy-7-tributylstannyloct-6-en-3-ol (PubChem CID 11365068) has the molecular formula C25H50O2S2Sn and a molecular weight of 565.52 g/mol. Its IUPAC name is (E,2S,3S)-1-(1,3-dithian-2-yl)-2-methoxy-7-tributylstannyloct-6-en-3-ol.
| Compound Name | (E,2S,3S)-1-(1,3-dithian-2-yl)-2-methoxy-7-tributylstannyloct-6-en-3-ol |
|---|---|
| PubChem CID | 11365068 |
| Molecular Formula | C25H50O2S2Sn |
| Molecular Weight | 565.52 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | (E,2S,3S)-1-(1,3-dithian-2-yl)-2-methoxy-7-tributylstannyloct-6-en-3-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(C)=C/CC[C@H](O)[C@H](CC1SCCCS1)OC |
| InChI | InChI=1S/C13H23O2S2.3C4H9.Sn/c1-3-4-5-7-11(14)12(15-2)10-13-16-8-6-9-17-13;3*1-3-4-2;/h4,11-14H,5-10H2,1-2H3;3*1,3-4H2,2H3;/t11-,12-;;;;/m0..../s1 |
| InChIKey | NIBUVUSBUOLEKK-RDKDOERDSA-N |
| XLogP | 8.06 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.52 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |