C21H36OS2 — CID 71528520
(3E,10E)-1-[2-[(E)-pent-3-enyl]-1,3-dithian-2-yl]dodeca-3,10-dien-1-ol (PubChem CID 71528520) has the molecular formula C21H36OS2 and a molecular weight of 368.65 g/mol. Its IUPAC name is (3E,10E)-1-[2-[(E)-pent-3-enyl]-1,3-dithian-2-yl]dodeca-3,10-dien-1-ol.
| Compound Name | (3E,10E)-1-[2-[(E)-pent-3-enyl]-1,3-dithian-2-yl]dodeca-3,10-dien-1-ol |
|---|---|
| PubChem CID | 71528520 |
| Molecular Formula | C21H36OS2 |
| Molecular Weight | 368.65 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | (3E,10E)-1-[2-[(E)-pent-3-enyl]-1,3-dithian-2-yl]dodeca-3,10-dien-1-ol |
| SMILES | C/C=C/CCCCC/C=C/CC(O)C1(CC/C=C/C)SCCCS1 |
| InChI | InChI=1S/C21H36OS2/c1-3-5-7-8-9-10-11-12-13-16-20(22)21(17-14-6-4-2)23-18-15-19-24-21/h3-6,12-13,20,22H,7-11,14-19H2,1-2H3/b5-3+,6-4+,13-12+ |
| InChIKey | HQCYBMNOPBBMKF-SAOIERAASA-N |
| XLogP | 6.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.65 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|