C14H23NO4 — CID 11369222
[(1S,6S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohept-3-en-1-yl] acetate (PubChem CID 11369222) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is [(1S,6S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohept-3-en-1-yl] acetate.
| Compound Name | [(1S,6S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohept-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 11369222 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [(1S,6S)-6-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohept-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC=CC[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H23NO4/c1-10(16)18-12-8-6-5-7-11(9-12)15-13(17)19-14(2,3)4/h5-6,11-12H,7-9H2,1-4H3,(H,15,17)/t11-,12-/m0/s1 |
| InChIKey | GDNZQSMCTSWWOH-RYUDHWBXSA-N |
| XLogP | 2.55 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|