C12H21NO3 — CID 163950000
tert-butyl N-(3-prop-1-en-2-yloxycyclobutyl)carbamate (PubChem CID 163950000) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl N-(3-prop-1-en-2-yloxycyclobutyl)carbamate.
| Compound Name | tert-butyl N-(3-prop-1-en-2-yloxycyclobutyl)carbamate |
|---|---|
| PubChem CID | 163950000 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | tert-butyl N-(3-prop-1-en-2-yloxycyclobutyl)carbamate |
| SMILES | C=C(C)OC1CC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H21NO3/c1-8(2)15-10-6-9(7-10)13-11(14)16-12(3,4)5/h9-10H,1,6-7H2,2-5H3,(H,13,14) |
| InChIKey | RYMHZMYOYGYCPH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|