C14H23NO3 — CID 165467173
tert-butyl N-[3-(3-methylbut-3-enoyl)cyclobutyl]carbamate (PubChem CID 165467173) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is tert-butyl N-[3-(3-methylbut-3-enoyl)cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-(3-methylbut-3-enoyl)cyclobutyl]carbamate |
|---|---|
| PubChem CID | 165467173 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | tert-butyl N-[3-(3-methylbut-3-enoyl)cyclobutyl]carbamate |
| SMILES | C=C(C)CC(=O)C1CC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H23NO3/c1-9(2)6-12(16)10-7-11(8-10)15-13(17)18-14(3,4)5/h10-11H,1,6-8H2,2-5H3,(H,15,17) |
| InChIKey | RAJMAWRJKPORNN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|