C11H18BrNO2 — CID 11369403
(3S,4R)-4-(1-bromo-2-methylpropan-2-yl)-3-methoxy-1-prop-2-enylazetidin-2-one (PubChem CID 11369403) has the molecular formula C11H18BrNO2 and a molecular weight of 276.17 g/mol. Its IUPAC name is (3S,4R)-4-(1-bromo-2-methylpropan-2-yl)-3-methoxy-1-prop-2-enylazetidin-2-one.
| Compound Name | (3S,4R)-4-(1-bromo-2-methylpropan-2-yl)-3-methoxy-1-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 11369403 |
| Molecular Formula | C11H18BrNO2 |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | (3S,4R)-4-(1-bromo-2-methylpropan-2-yl)-3-methoxy-1-prop-2-enylazetidin-2-one |
| SMILES | C=CCN1C(=O)[C@@H](OC)[C@H]1C(C)(C)CBr |
| InChI | InChI=1S/C11H18BrNO2/c1-5-6-13-9(11(2,3)7-12)8(15-4)10(13)14/h5,8-9H,1,6-7H2,2-4H3/t8-,9-/m0/s1 |
| InChIKey | UDCYSWKIMZYTCT-IUCAKERBSA-N |
| XLogP | 1.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|