C12H21NO2 — CID 24805703
(3S,4R)-4-tert-butyl-3-methoxy-1-(2-methylprop-2-enyl)azetidin-2-one (PubChem CID 24805703) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (3S,4R)-4-tert-butyl-3-methoxy-1-(2-methylprop-2-enyl)azetidin-2-one.
| Compound Name | (3S,4R)-4-tert-butyl-3-methoxy-1-(2-methylprop-2-enyl)azetidin-2-one |
|---|---|
| PubChem CID | 24805703 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (3S,4R)-4-tert-butyl-3-methoxy-1-(2-methylprop-2-enyl)azetidin-2-one |
| SMILES | C=C(C)CN1C(=O)[C@@H](OC)[C@H]1C(C)(C)C |
| InChI | InChI=1S/C12H21NO2/c1-8(2)7-13-10(12(3,4)5)9(15-6)11(13)14/h9-10H,1,7H2,2-6H3/t9-,10-/m0/s1 |
| InChIKey | BBLCZLHNDBMLIF-UWVGGRQHSA-N |
| XLogP | 1.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|