C11H19NO2 — CID 24805502
(3S,4R)-4-tert-butyl-3-methoxy-1-prop-2-enylazetidin-2-one (PubChem CID 24805502) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (3S,4R)-4-tert-butyl-3-methoxy-1-prop-2-enylazetidin-2-one.
| Compound Name | (3S,4R)-4-tert-butyl-3-methoxy-1-prop-2-enylazetidin-2-one |
|---|---|
| PubChem CID | 24805502 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (3S,4R)-4-tert-butyl-3-methoxy-1-prop-2-enylazetidin-2-one |
| SMILES | C=CCN1C(=O)[C@@H](OC)[C@H]1C(C)(C)C |
| InChI | InChI=1S/C11H19NO2/c1-6-7-12-9(11(2,3)4)8(14-5)10(12)13/h6,8-9H,1,7H2,2-5H3/t8-,9-/m0/s1 |
| InChIKey | WGTAMQNRMDWFPB-IUCAKERBSA-N |
| XLogP | 1.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|