C13H15ClN2OS — CID 11369582
N-[3-benzyl-4-(chloromethyl)-1,3-thiazolidin-2-ylidene]acetamide (PubChem CID 11369582) has the molecular formula C13H15ClN2OS and a molecular weight of 282.80 g/mol. Its IUPAC name is N-[3-benzyl-4-(chloromethyl)-1,3-thiazolidin-2-ylidene]acetamide.
| Compound Name | N-[3-benzyl-4-(chloromethyl)-1,3-thiazolidin-2-ylidene]acetamide |
|---|---|
| PubChem CID | 11369582 |
| Molecular Formula | C13H15ClN2OS |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-[3-benzyl-4-(chloromethyl)-1,3-thiazolidin-2-ylidene]acetamide |
| SMILES | CC(=O)/N=C1\SCC(CCl)N1Cc1ccccc1 |
| InChI | InChI=1S/C13H15ClN2OS/c1-10(17)15-13-16(12(7-14)9-18-13)8-11-5-3-2-4-6-11/h2-6,12H,7-9H2,1H3/b15-13- |
| InChIKey | PEFAOOFCZWMVTP-SQFISAMPSA-N |
| XLogP | 2.75 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|