C16H30O2S — CID 11369680
(2R,4R)-2-tert-butyl-4-methyl-4-octyl-1,3-oxathiolan-5-one (PubChem CID 11369680) has the molecular formula C16H30O2S and a molecular weight of 286.50 g/mol. Its IUPAC name is (2R,4R)-2-tert-butyl-4-methyl-4-octyl-1,3-oxathiolan-5-one.
| Compound Name | (2R,4R)-2-tert-butyl-4-methyl-4-octyl-1,3-oxathiolan-5-one |
|---|---|
| PubChem CID | 11369680 |
| Molecular Formula | C16H30O2S |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | (2R,4R)-2-tert-butyl-4-methyl-4-octyl-1,3-oxathiolan-5-one |
| SMILES | CCCCCCCC[C@@]1(C(=O)O[C@H](S1)C(C)(C)C)C |
| InChI | InChI=1S/C16H30O2S/c1-6-7-8-9-10-11-12-16(5)13(17)18-14(19-16)15(2,3)4/h14H,6-12H2,1-5H3/t14-,16-/m1/s1 |
| InChIKey | LLSPQVLMMYYUKR-GDBMZVCRSA-N |
| XLogP | 6.60 |
| TPSA | 51.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | 296 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|