C17H34O2Si2 — CID 11370827
tert-butyl-dimethyl-[(1S)-3-(1-trimethylsilyloxyethenyl)cyclohex-2-en-1-yl]oxysilane (PubChem CID 11370827) has the molecular formula C17H34O2Si2 and a molecular weight of 326.63 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S)-3-(1-trimethylsilyloxyethenyl)cyclohex-2-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1S)-3-(1-trimethylsilyloxyethenyl)cyclohex-2-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 11370827 |
| Molecular Formula | C17H34O2Si2 |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | tert-butyl-dimethyl-[(1S)-3-(1-trimethylsilyloxyethenyl)cyclohex-2-en-1-yl]oxysilane |
| SMILES | C=C(O[Si](C)(C)C)C1=C[C@@H](O[Si](C)(C)C(C)(C)C)CCC1 |
| InChI | InChI=1S/C17H34O2Si2/c1-14(18-20(5,6)7)15-11-10-12-16(13-15)19-21(8,9)17(2,3)4/h13,16H,1,10-12H2,2-9H3/t16-/m0/s1 |
| InChIKey | SFUWAILXZLEYCA-INIZCTEOSA-N |
| XLogP | 5.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|