C18H22N2O4 — CID 11370917
ethyl (E)-4-(2-benzyl-3,3-dimethyl-5-oxopyrazolidin-1-yl)-4-oxobut-2-enoate (PubChem CID 11370917) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is ethyl (E)-4-(2-benzyl-3,3-dimethyl-5-oxopyrazolidin-1-yl)-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-(2-benzyl-3,3-dimethyl-5-oxopyrazolidin-1-yl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 11370917 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | ethyl (E)-4-(2-benzyl-3,3-dimethyl-5-oxopyrazolidin-1-yl)-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)N1C(=O)CC(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H22N2O4/c1-4-24-17(23)11-10-15(21)20-16(22)12-18(2,3)19(20)13-14-8-6-5-7-9-14/h5-11H,4,12-13H2,1-3H3/b11-10+ |
| InChIKey | BKNCBGVSYPEPNO-ZHACJKMWSA-N |
| XLogP | 2.06 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|