C18H12Cl2O2 — CID 11370939
(2Z,3Z)-2,3-bis[(3-chlorophenyl)methylidene]butanedial (PubChem CID 11370939) has the molecular formula C18H12Cl2O2 and a molecular weight of 331.20 g/mol. Its IUPAC name is (2Z,3Z)-2,3-bis[(3-chlorophenyl)methylidene]butanedial.
| Compound Name | (2Z,3Z)-2,3-bis[(3-chlorophenyl)methylidene]butanedial |
|---|---|
| PubChem CID | 11370939 |
| Molecular Formula | C18H12Cl2O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | (2Z,3Z)-2,3-bis[(3-chlorophenyl)methylidene]butanedial |
| SMILES | O=CC(=C\c1cccc(Cl)c1)/C(C=O)=C/c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H12Cl2O2/c19-17-5-1-3-13(9-17)7-15(11-21)16(12-22)8-14-4-2-6-18(20)10-14/h1-12H/b15-7+,16-8+ |
| InChIKey | ASHQQRRSSLFGES-BGPOSVGRSA-N |
| XLogP | 4.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|