C22H36N2O3S — CID 11373195
3-(3-heptyl-8-methoxy-3-azabicyclo[3.2.1]octan-8-yl)-N-methylbenzenesulfonamide (PubChem CID 11373195) has the molecular formula C22H36N2O3S and a molecular weight of 408.61 g/mol. Its IUPAC name is 3-(3-heptyl-8-methoxy-3-azabicyclo[3.2.1]octan-8-yl)-N-methylbenzenesulfonamide.
| Compound Name | 3-(3-heptyl-8-methoxy-3-azabicyclo[3.2.1]octan-8-yl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11373195 |
| Molecular Formula | C22H36N2O3S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 3-(3-heptyl-8-methoxy-3-azabicyclo[3.2.1]octan-8-yl)-N-methylbenzenesulfonamide |
| SMILES | CCCCCCCN1CC2CCC(C1)C2(OC)c1cccc(S(=O)(=O)NC)c1 |
| InChI | InChI=1S/C22H36N2O3S/c1-4-5-6-7-8-14-24-16-19-12-13-20(17-24)22(19,27-3)18-10-9-11-21(15-18)28(25,26)23-2/h9-11,15,19-20,23H,4-8,12-14,16-17H2,1-3H3 |
| InChIKey | PJGPBWOQSAXYSC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|