C22H42O4Si2 — CID 11373685
(3E,5R,6R,7E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]deca-3,7-diene-2,9-dione (PubChem CID 11373685) has the molecular formula C22H42O4Si2 and a molecular weight of 426.75 g/mol. Its IUPAC name is (3E,5R,6R,7E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]deca-3,7-diene-2,9-dione.
| Compound Name | (3E,5R,6R,7E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]deca-3,7-diene-2,9-dione |
|---|---|
| PubChem CID | 11373685 |
| Molecular Formula | C22H42O4Si2 |
| Molecular Weight | 426.75 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (3E,5R,6R,7E)-5,6-bis[[tert-butyl(dimethyl)silyl]oxy]deca-3,7-diene-2,9-dione |
| SMILES | CC(=O)/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/C(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O4Si2/c1-17(23)13-15-19(25-27(9,10)21(3,4)5)20(16-14-18(2)24)26-28(11,12)22(6,7)8/h13-16,19-20H,1-12H3/b15-13+,16-14+/t19-,20-/m1/s1 |
| InChIKey | HEVHIJZDBBAZAO-AFYOVXRGSA-N |
| XLogP | 6.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.75 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|