C33H62O4Si3 — CID 132607458
(2R,4E,6E,8E,10E,12R,13R)-2,12,13-tris[[tert-butyl(dimethyl)silyl]oxy]pentadeca-4,6,8,10,14-pentaen-3-one (PubChem CID 132607458) has the molecular formula C33H62O4Si3 and a molecular weight of 607.11 g/mol. Its IUPAC name is (2R,4E,6E,8E,10E,12R,13R)-2,12,13-tris[[tert-butyl(dimethyl)silyl]oxy]pentadeca-4,6,8,10,14-pentaen-3-one.
| Compound Name | (2R,4E,6E,8E,10E,12R,13R)-2,12,13-tris[[tert-butyl(dimethyl)silyl]oxy]pentadeca-4,6,8,10,14-pentaen-3-one |
|---|---|
| PubChem CID | 132607458 |
| Molecular Formula | C33H62O4Si3 |
| Molecular Weight | 607.11 g/mol |
| Exact Mass | 606.40 |
| IUPAC Name | (2R,4E,6E,8E,10E,12R,13R)-2,12,13-tris[[tert-butyl(dimethyl)silyl]oxy]pentadeca-4,6,8,10,14-pentaen-3-one |
| SMILES | C=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](/C=C/C=C/C=C/C=C/C(=O)[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H62O4Si3/c1-18-29(36-39(14,15)32(6,7)8)30(37-40(16,17)33(9,10)11)26-24-22-20-19-21-23-25-28(34)27(2)35-38(12,13)31(3,4)5/h18-27,29-30H,1H2,2-17H3/b21-19+,22-20+,25-23+,26-24+/t27-,29-,30-/m1/s1 |
| InChIKey | QELBBXWPSRKTCC-YBABXLHOSA-N |
| XLogP | 10.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.11 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|