C26H54O4Si3 — CID 10052206
(2E,4S,5S,6E)-4,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienal (PubChem CID 10052206) has the molecular formula C26H54O4Si3 and a molecular weight of 514.97 g/mol. Its IUPAC name is (2E,4S,5S,6E)-4,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienal.
| Compound Name | (2E,4S,5S,6E)-4,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienal |
|---|---|
| PubChem CID | 10052206 |
| Molecular Formula | C26H54O4Si3 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | (2E,4S,5S,6E)-4,5,8-tris[[tert-butyl(dimethyl)silyl]oxy]octa-2,6-dienal |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H54O4Si3/c1-24(2,3)31(10,11)28-21-17-19-23(30-33(14,15)26(7,8)9)22(18-16-20-27)29-32(12,13)25(4,5)6/h16-20,22-23H,21H2,1-15H3/b18-16+,19-17+/t22-,23-/m0/s1 |
| InChIKey | BRCAFDOEXUPKGT-CHCWKLOASA-N |
| XLogP | 8.10 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|