About cyclohept-2-en-1-yl methyl carbonate
cyclohept-2-en-1-yl methyl carbonate (PubChem CID 11378741) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is cyclohept-2-en-1-yl methyl carbonate.
Molecular Properties
| Compound Name | cyclohept-2-en-1-yl methyl carbonate |
| PubChem CID | 11378741 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | cyclohept-2-en-1-yl methyl carbonate |
| SMILES | COC(=O)OC1C=CCCCC1 |
| InChI | InChI=1S/C9H14O3/c1-11-9(10)12-8-6-4-2-3-5-7-8/h4,6,8H,2-3,5,7H2,1H3 |
| InChIKey | JBNXIJQCLFLBPX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclohept-2-en-1-yl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohept-2-en-1-yl methyl carbonate?
The IUPAC name of cyclohept-2-en-1-yl methyl carbonate (CID 11378741) is cyclohept-2-en-1-yl methyl carbonate.
What is the SMILES notation for cyclohept-2-en-1-yl methyl carbonate?
The canonical SMILES for cyclohept-2-en-1-yl methyl carbonate is COC(=O)OC1C=CCCCC1.
What is the InChIKey of cyclohept-2-en-1-yl methyl carbonate?
The InChIKey is JBNXIJQCLFLBPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-11-9(10)12-8-6-4-2-3-5-7-8/h4,6,8H,2-3,5,7H2,1H3.
What are the key properties of cyclohept-2-en-1-yl methyl carbonate?
cyclohept-2-en-1-yl methyl carbonate has a molecular weight of 170.21 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohept-2-en-1-yl methyl carbonate is sourced from PubChem (CID 11378741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).