C8H18N2O2 — CID 11378791
(3R,4R)-1-[2-(ethylamino)ethyl]pyrrolidine-3,4-diol (PubChem CID 11378791) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is (3R,4R)-1-[2-(ethylamino)ethyl]pyrrolidine-3,4-diol.
| Compound Name | (3R,4R)-1-[2-(ethylamino)ethyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 11378791 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (3R,4R)-1-[2-(ethylamino)ethyl]pyrrolidine-3,4-diol |
| SMILES | CCNCCN1C[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C8H18N2O2/c1-2-9-3-4-10-5-7(11)8(12)6-10/h7-9,11-12H,2-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | XWESAQGAVOOCNP-HTQZYQBOSA-N |
| XLogP | -1.37 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|