C19H13NO3 — CID 11381128
2-(3-methoxyphenyl)pyrido[1,2-b]isoindole-4,6-dione (PubChem CID 11381128) has the molecular formula C19H13NO3 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)pyrido[1,2-b]isoindole-4,6-dione.
| Compound Name | 2-(3-methoxyphenyl)pyrido[1,2-b]isoindole-4,6-dione |
|---|---|
| PubChem CID | 11381128 |
| Molecular Formula | C19H13NO3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-(3-methoxyphenyl)pyrido[1,2-b]isoindole-4,6-dione |
| SMILES | COc1cccc(-c2cc3n(c(=O)c2)C(=O)c2ccccc2-3)c1 |
| InChI | InChI=1S/C19H13NO3/c1-23-14-6-4-5-12(9-14)13-10-17-15-7-2-3-8-16(15)19(22)20(17)18(21)11-13/h2-11H,1H3 |
| InChIKey | WGVUOZKLLVXKME-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |