C21H18ClNO — CID 11382092
7-chloro-3,3-dimethyl-9-phenyl-2,4-dihydroacridin-1-one (PubChem CID 11382092) has the molecular formula C21H18ClNO and a molecular weight of 335.83 g/mol. Its IUPAC name is 7-chloro-3,3-dimethyl-9-phenyl-2,4-dihydroacridin-1-one.
| Compound Name | 7-chloro-3,3-dimethyl-9-phenyl-2,4-dihydroacridin-1-one |
|---|---|
| PubChem CID | 11382092 |
| Molecular Formula | C21H18ClNO |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 7-chloro-3,3-dimethyl-9-phenyl-2,4-dihydroacridin-1-one |
| SMILES | CC1(C)CC(=O)c2c(nc3ccc(Cl)cc3c2-c2ccccc2)C1 |
| InChI | InChI=1S/C21H18ClNO/c1-21(2)11-17-20(18(24)12-21)19(13-6-4-3-5-7-13)15-10-14(22)8-9-16(15)23-17/h3-10H,11-12H2,1-2H3 |
| InChIKey | QSSVASUDWSXNEV-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |