C15H16N2O — CID 617614
9-amino-3,3-dimethyl-2,4-dihydroacridin-1-one (PubChem CID 617614) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 9-amino-3,3-dimethyl-2,4-dihydroacridin-1-one.
| Compound Name | 9-amino-3,3-dimethyl-2,4-dihydroacridin-1-one |
|---|---|
| PubChem CID | 617614 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 9-amino-3,3-dimethyl-2,4-dihydroacridin-1-one |
| SMILES | CC1(C)CC(=O)c2c(nc3ccccc3c2N)C1 |
| InChI | InChI=1S/C15H16N2O/c1-15(2)7-11-13(12(18)8-15)14(16)9-5-3-4-6-10(9)17-11/h3-6H,7-8H2,1-2H3,(H2,16,17) |
| InChIKey | RFXDMILSJZCTDQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |