C12H15NO — CID 5055591
2,7,7-trimethyl-6,8-dihydroquinolin-5-one (PubChem CID 5055591) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 2,7,7-trimethyl-6,8-dihydroquinolin-5-one.
| Compound Name | 2,7,7-trimethyl-6,8-dihydroquinolin-5-one |
|---|---|
| PubChem CID | 5055591 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2,7,7-trimethyl-6,8-dihydroquinolin-5-one |
| SMILES | Cc1ccc2c(n1)CC(C)(C)CC2=O |
| InChI | InChI=1S/C12H15NO/c1-8-4-5-9-10(13-8)6-12(2,3)7-11(9)14/h4-5H,6-7H2,1-3H3 |
| InChIKey | NFYVZLSUTSXLEN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |