C20H18ClNO4 — CID 11383157
methyl (2E)-2-[(2S,3S)-2-(4-chlorophenyl)-3-methylcyclopropylidene]-3-(4-nitrophenyl)propanoate (PubChem CID 11383157) has the molecular formula C20H18ClNO4 and a molecular weight of 371.82 g/mol. Its IUPAC name is methyl (2E)-2-[(2S,3S)-2-(4-chlorophenyl)-3-methylcyclopropylidene]-3-(4-nitrophenyl)propanoate.
| Compound Name | methyl (2E)-2-[(2S,3S)-2-(4-chlorophenyl)-3-methylcyclopropylidene]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 11383157 |
| Molecular Formula | C20H18ClNO4 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | methyl (2E)-2-[(2S,3S)-2-(4-chlorophenyl)-3-methylcyclopropylidene]-3-(4-nitrophenyl)propanoate |
| SMILES | COC(=O)/C(Cc1ccc([N+](=O)[O-])cc1)=C1\[C@@H](C)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO4/c1-12-18(14-5-7-15(21)8-6-14)19(12)17(20(23)26-2)11-13-3-9-16(10-4-13)22(24)25/h3-10,12,18H,11H2,1-2H3/b19-17+/t12-,18-/m0/s1 |
| InChIKey | PSAVRTLMRBCQGF-VAVPWIAPSA-N |
| XLogP | 4.69 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|