C21H20ClNO4 — CID 11749485
trans-methyl (1S,2R)-2-(4-chlorophenyl)-1-[(4-nitrophenyl)methyl]-3-propan-2-ylidenecyclopropane-1-carboxylate (PubChem CID 11749485) has the molecular formula C21H20ClNO4 and a molecular weight of 385.85 g/mol. Its IUPAC name is trans-methyl (1S,2R)-2-(4-chlorophenyl)-1-[(4-nitrophenyl)methyl]-3-propan-2-ylidenecyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1S,2R)-2-(4-chlorophenyl)-1-[(4-nitrophenyl)methyl]-3-propan-2-ylidenecyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11749485 |
| Molecular Formula | C21H20ClNO4 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | trans-methyl (1S,2R)-2-(4-chlorophenyl)-1-[(4-nitrophenyl)methyl]-3-propan-2-ylidenecyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@]1(Cc2ccc([N+](=O)[O-])cc2)C(=C(C)C)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20ClNO4/c1-13(2)18-19(15-6-8-16(22)9-7-15)21(18,20(24)27-3)12-14-4-10-17(11-5-14)23(25)26/h4-11,19H,12H2,1-3H3/t19-,21-/m1/s1 |
| InChIKey | KNXNRXZMRIBVNI-TZIWHRDSSA-N |
| XLogP | 5.08 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|