C20H18ClN3O4 — CID 23250435
methyl (3R,4Z,5S)-4-[(4-chlorophenyl)methylidene]-3-methyl-5-[(4-nitrophenyl)methyl]-3H-pyrazole-5-carboxylate (PubChem CID 23250435) has the molecular formula C20H18ClN3O4 and a molecular weight of 399.83 g/mol. Its IUPAC name is methyl (3R,4Z,5S)-4-[(4-chlorophenyl)methylidene]-3-methyl-5-[(4-nitrophenyl)methyl]-3H-pyrazole-5-carboxylate.
| Compound Name | methyl (3R,4Z,5S)-4-[(4-chlorophenyl)methylidene]-3-methyl-5-[(4-nitrophenyl)methyl]-3H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 23250435 |
| Molecular Formula | C20H18ClN3O4 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | methyl (3R,4Z,5S)-4-[(4-chlorophenyl)methylidene]-3-methyl-5-[(4-nitrophenyl)methyl]-3H-pyrazole-5-carboxylate |
| SMILES | COC(=O)[C@@]1(Cc2ccc([N+](=O)[O-])cc2)N=N[C@H](C)/C1=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClN3O4/c1-13-18(11-14-3-7-16(21)8-4-14)20(23-22-13,19(25)28-2)12-15-5-9-17(10-6-15)24(26)27/h3-11,13H,12H2,1-2H3/b18-11-/t13-,20+/m1/s1 |
| InChIKey | ZSCCYTJLHIURTJ-YWEFBPSLSA-N |
| XLogP | 4.64 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|