C26H34O3 — CID 11383856
(1R,3R,3aS,4S,5R,7aS)-4,5,7-triethyl-1,3-dimethyl-2-oxo-5-[(E)-2-phenylethenyl]-1,3,3a,7a-tetrahydroindene-4-carboxylic acid (PubChem CID 11383856) has the molecular formula C26H34O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is (1R,3R,3aS,4S,5R,7aS)-4,5,7-triethyl-1,3-dimethyl-2-oxo-5-[(E)-2-phenylethenyl]-1,3,3a,7a-tetrahydroindene-4-carboxylic acid.
| Compound Name | (1R,3R,3aS,4S,5R,7aS)-4,5,7-triethyl-1,3-dimethyl-2-oxo-5-[(E)-2-phenylethenyl]-1,3,3a,7a-tetrahydroindene-4-carboxylic acid |
|---|---|
| PubChem CID | 11383856 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (1R,3R,3aS,4S,5R,7aS)-4,5,7-triethyl-1,3-dimethyl-2-oxo-5-[(E)-2-phenylethenyl]-1,3,3a,7a-tetrahydroindene-4-carboxylic acid |
| SMILES | CCC1=C[C@](/C=C/c2ccccc2)(CC)[C@@](CC)(C(=O)O)[C@H]2[C@H]1[C@@H](C)C(=O)[C@@H]2C |
| InChI | InChI=1S/C26H34O3/c1-6-20-16-25(7-2,15-14-19-12-10-9-11-13-19)26(8-3,24(28)29)22-18(5)23(27)17(4)21(20)22/h9-18,21-22H,6-8H2,1-5H3,(H,28,29)/b15-14+/t17-,18-,21+,22-,25-,26-/m1/s1 |
| InChIKey | UQEJAGGYKHOOEK-HULWJSGJSA-N |
| XLogP | 6.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|