C21H29NO2Se — CID 11384213
(3R,5R,6S)-6,10-dimethyl-3-[(2S)-1-(2-nitrophenyl)selanylpropan-2-yl]spiro[4.5]dec-9-ene (PubChem CID 11384213) has the molecular formula C21H29NO2Se and a molecular weight of 406.43 g/mol. Its IUPAC name is (3R,5R,6S)-6,10-dimethyl-3-[(2S)-1-(2-nitrophenyl)selanylpropan-2-yl]spiro[4.5]dec-9-ene.
| Compound Name | (3R,5R,6S)-6,10-dimethyl-3-[(2S)-1-(2-nitrophenyl)selanylpropan-2-yl]spiro[4.5]dec-9-ene |
|---|---|
| PubChem CID | 11384213 |
| Molecular Formula | C21H29NO2Se |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (3R,5R,6S)-6,10-dimethyl-3-[(2S)-1-(2-nitrophenyl)selanylpropan-2-yl]spiro[4.5]dec-9-ene |
| SMILES | CC1=CCC[C@H](C)[C@]12CC[C@@H]([C@H](C)C[Se]c1ccccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C21H29NO2Se/c1-15(14-25-20-10-5-4-9-19(20)22(23)24)18-11-12-21(13-18)16(2)7-6-8-17(21)3/h4-5,7,9-10,15,17-18H,6,8,11-14H2,1-3H3/t15-,17+,18-,21+/m1/s1 |
| InChIKey | OVXAMSLRDLWLGN-HVSHLEFESA-N |
| XLogP | 5.14 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|