C25H32N2O4 — CID 11384722
CID 11384722 (PubChem CID 11384722) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol.
| Compound Name | CID 11384722 |
|---|---|
| PubChem CID | 11384722 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | — |
| SMILES | CC(C)=COc1ccc(/C=C2/C(=O)N(C)[C@@H]3CN2C2(CCC4(CC2)OCCO4)C3)cc1 |
| InChI | InChI=1S/C25H32N2O4/c1-18(2)17-29-21-6-4-19(5-7-21)14-22-23(28)26(3)20-15-24(27(22)16-20)8-10-25(11-9-24)30-12-13-31-25/h4-7,14,17,20H,8-13,15-16H2,1-3H3/b22-14-/t20-/m0/s1 |
| InChIKey | UQBFVVFTOCCBRI-ALFKQNEGSA-N |
| XLogP | 3.93 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|